C31H38O4 — CID 142982117
3-hydroxy-2-[4-[2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-1,3-dioxan-2-yl]phenyl]cyclohexan-1-one (PubChem CID 142982117) has the molecular formula C31H38O4 and a molecular weight of 474.64 g/mol. Its IUPAC name is 3-hydroxy-2-[4-[2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-1,3-dioxan-2-yl]phenyl]cyclohexan-1-one.
| Compound Name | 3-hydroxy-2-[4-[2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-1,3-dioxan-2-yl]phenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 142982117 |
| Molecular Formula | C31H38O4 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 3-hydroxy-2-[4-[2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-1,3-dioxan-2-yl]phenyl]cyclohexan-1-one |
| SMILES | Cc1cc2c(cc1C1(c3ccc(C4C(=O)CCCC4O)cc3)OCCCO1)C(C)(C)C=CC2(C)C |
| InChI | InChI=1S/C31H38O4/c1-20-18-24-25(30(4,5)15-14-29(24,2)3)19-23(20)31(34-16-7-17-35-31)22-12-10-21(11-13-22)28-26(32)8-6-9-27(28)33/h10-15,18-19,26,28,32H,6-9,16-17H2,1-5H3 |
| InChIKey | UTIPRURTLHNYPY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|