C29H35ClF3N — CID 142982183
1-[(2E)-1-(5-chlorocyclohepta-1,4,6-trien-1-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-3-[1-(3,5-difluorocyclohexa-1,3-dien-1-yl)-2-fluoro-2-methylpropyl]pyrrolidine (PubChem CID 142982183) has the molecular formula C29H35ClF3N and a molecular weight of 490.05 g/mol. Its IUPAC name is 1-[(2E)-1-(5-chlorocyclohepta-1,4,6-trien-1-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-3-[1-(3,5-difluorocyclohexa-1,3-dien-1-yl)-2-fluoro-2-methylpropyl]pyrrolidine.
| Compound Name | 1-[(2E)-1-(5-chlorocyclohepta-1,4,6-trien-1-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-3-[1-(3,5-difluorocyclohexa-1,3-dien-1-yl)-2-fluoro-2-methylpropyl]pyrrolidine |
|---|---|
| PubChem CID | 142982183 |
| Molecular Formula | C29H35ClF3N |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 1-[(2E)-1-(5-chlorocyclohepta-1,4,6-trien-1-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-3-[1-(3,5-difluorocyclohexa-1,3-dien-1-yl)-2-fluoro-2-methylpropyl]pyrrolidine |
| SMILES | C=C/C=C(\C=C/C)C(C1=CCC=C(Cl)C=C1)N1CCC(C(C2=CC(F)=CC(F)C2)C(C)(C)F)C1 |
| InChI | InChI=1S/C29H35ClF3N/c1-5-8-20(9-6-2)28(21-10-7-11-24(30)13-12-21)34-15-14-22(19-34)27(29(3,4)33)23-16-25(31)18-26(32)17-23/h5-6,8-13,16,18,22,26-28H,1,7,14-15,17,19H2,2-4H3/b9-6-,20-8+ |
| InChIKey | OYZFVWRHSIMWAM-MYYXYXECSA-N |
| XLogP | 8.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|