About 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid
2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid (PubChem CID 142982260) has the molecular formula C8H13NO3S
and a molecular weight of 203.26 g/mol. Its IUPAC name is 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid.
Molecular Properties
| Compound Name | 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid |
| PubChem CID | 142982260 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid |
| SMILES | NC(CS(=O)(=O)O)C1C=CC=CC1 |
| InChI | InChI=1S/C8H13NO3S/c9-8(6-13(10,11)12)7-4-2-1-3-5-7/h1-4,7-8H,5-6,9H2,(H,10,11,12) |
| InChIKey | TVYYJUYYFXGCEV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid?
The IUPAC name of 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid (CID 142982260) is 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid.
What is the SMILES notation for 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid?
The canonical SMILES for 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid is NC(CS(=O)(=O)O)C1C=CC=CC1.
What is the InChIKey of 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid?
The InChIKey is TVYYJUYYFXGCEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3S/c9-8(6-13(10,11)12)7-4-2-1-3-5-7/h1-4,7-8H,5-6,9H2,(H,10,11,12).
What are the key properties of 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid?
2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid has a molecular weight of 203.26 g/mol, XLogP of 0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-cyclohexa-2,4-dien-1-ylethanesulfonic acid is sourced from PubChem (CID 142982260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).