C16H25NO3S — CID 142982277
2-amino-2-naphthalen-2-ylethanesulfonic acid;ethane (PubChem CID 142982277) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-amino-2-naphthalen-2-ylethanesulfonic acid;ethane.
| Compound Name | 2-amino-2-naphthalen-2-ylethanesulfonic acid;ethane |
|---|---|
| PubChem CID | 142982277 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-amino-2-naphthalen-2-ylethanesulfonic acid;ethane |
| SMILES | CC.CC.NC(CS(=O)(=O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H13NO3S.2C2H6/c13-12(8-17(14,15)16)11-6-5-9-3-1-2-4-10(9)7-11;2*1-2/h1-7,12H,8,13H2,(H,14,15,16);2*1-2H3 |
| InChIKey | GPVXPMIBWSKUCY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|