C13H21NO3S — CID 142982286
2-amino-3-[(2Z,4Z)-hepta-2,4,6-trienyl]cyclohexane-1-sulfonic acid (PubChem CID 142982286) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is 2-amino-3-[(2Z,4Z)-hepta-2,4,6-trienyl]cyclohexane-1-sulfonic acid.
| Compound Name | 2-amino-3-[(2Z,4Z)-hepta-2,4,6-trienyl]cyclohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 142982286 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-amino-3-[(2Z,4Z)-hepta-2,4,6-trienyl]cyclohexane-1-sulfonic acid |
| SMILES | C=C/C=C\C=C/CC1CCCC(S(=O)(=O)O)C1N |
| InChI | InChI=1S/C13H21NO3S/c1-2-3-4-5-6-8-11-9-7-10-12(13(11)14)18(15,16)17/h2-6,11-13H,1,7-10,14H2,(H,15,16,17)/b4-3-,6-5- |
| InChIKey | YOOWHSWKSJQZDM-OUPQRBNQSA-N |
| XLogP | 2.06 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|