C31H35FN6O6S — CID 142982361
(2S)-2-[[2-(diethylamino)-5-[ethynyl-(4-fluorophenyl)sulfonylamino]pyrimidin-4-yl]amino]-4-[4-(pyrrolidine-1-carbonyloxy)phenyl]butanoic acid (PubChem CID 142982361) has the molecular formula C31H35FN6O6S and a molecular weight of 638.72 g/mol. Its IUPAC name is (2S)-2-[[2-(diethylamino)-5-[ethynyl-(4-fluorophenyl)sulfonylamino]pyrimidin-4-yl]amino]-4-[4-(pyrrolidine-1-carbonyloxy)phenyl]butanoic acid.
| Compound Name | (2S)-2-[[2-(diethylamino)-5-[ethynyl-(4-fluorophenyl)sulfonylamino]pyrimidin-4-yl]amino]-4-[4-(pyrrolidine-1-carbonyloxy)phenyl]butanoic acid |
|---|---|
| PubChem CID | 142982361 |
| Molecular Formula | C31H35FN6O6S |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | (2S)-2-[[2-(diethylamino)-5-[ethynyl-(4-fluorophenyl)sulfonylamino]pyrimidin-4-yl]amino]-4-[4-(pyrrolidine-1-carbonyloxy)phenyl]butanoic acid |
| SMILES | C#CN(c1cnc(N(CC)CC)nc1N[C@@H](CCc1ccc(OC(=O)N2CCCC2)cc1)C(=O)O)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H35FN6O6S/c1-4-36(5-2)30-33-21-27(38(6-3)45(42,43)25-16-12-23(32)13-17-25)28(35-30)34-26(29(39)40)18-11-22-9-14-24(15-10-22)44-31(41)37-19-7-8-20-37/h3,9-10,12-17,21,26H,4-5,7-8,11,18-20H2,1-2H3,(H,39,40)(H,33,34,35)/t26-/m0/s1 |
| InChIKey | JQDQWVBLLUVOLC-SANMLTNESA-N |
| XLogP | 4.34 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|