About 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide
4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide (PubChem CID 1429829) has the molecular formula C20H21N3O3
and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide |
| PubChem CID | 1429829 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCC(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C20H21N3O3/c1-25-17-8-4-2-6-15(17)22-20(24)23-12-10-14(11-13-23)19-21-16-7-3-5-9-18(16)26-19/h2-9,14H,10-13H2,1H3,(H,22,24) |
| InChIKey | QFIGQDYCDJATMC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide?
The IUPAC name of 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide (CID 1429829) is 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide.
What is the SMILES notation for 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide?
The canonical SMILES for 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide is COc1ccccc1NC(=O)N1CCC(c2nc3ccccc3o2)CC1.
What is the InChIKey of 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide?
The InChIKey is QFIGQDYCDJATMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O3/c1-25-17-8-4-2-6-15(17)22-20(24)23-12-10-14(11-13-23)19-21-16-7-3-5-9-18(16)26-19/h2-9,14H,10-13H2,1H3,(H,22,24).
What are the key properties of 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide?
4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide has a molecular weight of 351.41 g/mol, XLogP of 4.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-1-carboxamide is sourced from PubChem (CID 1429829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).