About [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate
[(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate (PubChem CID 142982911) has the molecular formula C14H25NS
and a molecular weight of 239.43 g/mol. Its IUPAC name is [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate.
Molecular Properties
| Compound Name | [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate |
| PubChem CID | 142982911 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate |
| SMILES | C=C(C)/C=C/S/C(=N\C)C(CCC)CCC |
| InChI | InChI=1S/C14H25NS/c1-6-8-13(9-7-2)14(15-5)16-11-10-12(3)4/h10-11,13H,3,6-9H2,1-2,4-5H3/b11-10+,15-14- |
| InChIKey | JMSQLRTXRYWDHK-RZTSRGAQSA-N |
| XLogP | 5.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate?
The IUPAC name of [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate (CID 142982911) is [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate.
What is the SMILES notation for [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate?
The canonical SMILES for [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate is C=C(C)/C=C/S/C(=N\C)C(CCC)CCC.
What is the InChIKey of [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate?
The InChIKey is JMSQLRTXRYWDHK-RZTSRGAQSA-N. The full InChI is InChI=1S/C14H25NS/c1-6-8-13(9-7-2)14(15-5)16-11-10-12(3)4/h10-11,13H,3,6-9H2,1-2,4-5H3/b11-10+,15-14-.
What are the key properties of [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate?
[(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate has a molecular weight of 239.43 g/mol, XLogP of 5.05, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-3-methylbuta-1,3-dienyl] N-methyl-2-propylpentanimidothioate is sourced from PubChem (CID 142982911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).