C23H23FN6O4 — CID 142983866
2-[4-[(2-fluoro-6-methylbenzoyl)amino]-1H-pyrazol-5-yl]-N-[2-(2-hydroxyethoxy)ethyl]-3H-benzimidazole-5-carboxamide (PubChem CID 142983866) has the molecular formula C23H23FN6O4 and a molecular weight of 466.47 g/mol. Its IUPAC name is 2-[4-[(2-fluoro-6-methylbenzoyl)amino]-1H-pyrazol-5-yl]-N-[2-(2-hydroxyethoxy)ethyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-[(2-fluoro-6-methylbenzoyl)amino]-1H-pyrazol-5-yl]-N-[2-(2-hydroxyethoxy)ethyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 142983866 |
| Molecular Formula | C23H23FN6O4 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-[4-[(2-fluoro-6-methylbenzoyl)amino]-1H-pyrazol-5-yl]-N-[2-(2-hydroxyethoxy)ethyl]-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1cccc(F)c1C(=O)Nc1cn[nH]c1-c1nc2ccc(C(=O)NCCOCCO)cc2[nH]1 |
| InChI | InChI=1S/C23H23FN6O4/c1-13-3-2-4-15(24)19(13)23(33)29-18-12-26-30-20(18)21-27-16-6-5-14(11-17(16)28-21)22(32)25-7-9-34-10-8-31/h2-6,11-12,31H,7-10H2,1H3,(H,25,32)(H,26,30)(H,27,28)(H,29,33) |
| InChIKey | LMONREPSWWESQV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|