C28H49NO2 — CID 142984394
8-[(3E,5Z)-7-(cyclohepta-1,3,6-trien-1-ylmethoxy)hepta-1,3,5-trien-4-yl]oxyoctan-1-amine;ethane;propane (PubChem CID 142984394) has the molecular formula C28H49NO2 and a molecular weight of 431.71 g/mol. Its IUPAC name is 8-[(3E,5Z)-7-(cyclohepta-1,3,6-trien-1-ylmethoxy)hepta-1,3,5-trien-4-yl]oxyoctan-1-amine;ethane;propane.
| Compound Name | 8-[(3E,5Z)-7-(cyclohepta-1,3,6-trien-1-ylmethoxy)hepta-1,3,5-trien-4-yl]oxyoctan-1-amine;ethane;propane |
|---|---|
| PubChem CID | 142984394 |
| Molecular Formula | C28H49NO2 |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 431.38 |
| IUPAC Name | 8-[(3E,5Z)-7-(cyclohepta-1,3,6-trien-1-ylmethoxy)hepta-1,3,5-trien-4-yl]oxyoctan-1-amine;ethane;propane |
| SMILES | C=C/C=C(\C=C/COCC1=CC=CCC=C1)OCCCCCCCCN.CC.CCC |
| InChI | InChI=1S/C23H35NO2.C3H8.C2H6/c1-2-14-23(26-20-12-8-4-3-7-11-18-24)17-13-19-25-21-22-15-9-5-6-10-16-22;1-3-2;1-2/h2,5,9-10,13-17H,1,3-4,6-8,11-12,18-21,24H2;3H2,1-2H3;1-2H3/b17-13-,23-14+;; |
| InChIKey | SPGLWMIDYVHHNS-GDEGYNIASA-N |
| XLogP | 7.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|