C23H35NO2 — CID 142984395
8-[(3E,5Z)-7-(cyclohepta-1,3,6-trien-1-ylmethoxy)hepta-1,3,5-trien-4-yl]oxyoctan-1-amine (PubChem CID 142984395) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is 8-[(3E,5Z)-7-(cyclohepta-1,3,6-trien-1-ylmethoxy)hepta-1,3,5-trien-4-yl]oxyoctan-1-amine.
| Compound Name | 8-[(3E,5Z)-7-(cyclohepta-1,3,6-trien-1-ylmethoxy)hepta-1,3,5-trien-4-yl]oxyoctan-1-amine |
|---|---|
| PubChem CID | 142984395 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | 8-[(3E,5Z)-7-(cyclohepta-1,3,6-trien-1-ylmethoxy)hepta-1,3,5-trien-4-yl]oxyoctan-1-amine |
| SMILES | C=C/C=C(\C=C/COCC1=CC=CCC=C1)OCCCCCCCCN |
| InChI | InChI=1S/C23H35NO2/c1-2-14-23(26-20-12-8-4-3-7-11-18-24)17-13-19-25-21-22-15-9-5-6-10-16-22/h2,5,9-10,13-17H,1,3-4,6-8,11-12,18-21,24H2/b17-13-,23-14+ |
| InChIKey | FGRDXSLRVLZVDP-XSSYQAJCSA-N |
| XLogP | 5.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|