About 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite
2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite (PubChem CID 142985499) has the molecular formula C14H21IO4S
and a molecular weight of 412.29 g/mol. Its IUPAC name is 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite.
Molecular Properties
| Compound Name | 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite |
| PubChem CID | 142985499 |
| Molecular Formula | C14H21IO4S |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite |
| SMILES | CCc1c(OC)c(C)c(C)c(COO)c1OCCSI |
| InChI | InChI=1S/C14H21IO4S/c1-5-11-13(17-4)10(3)9(2)12(8-19-16)14(11)18-6-7-20-15/h16H,5-8H2,1-4H3 |
| InChIKey | MZLCTQDZDFXSJS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite?
The IUPAC name of 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite (CID 142985499) is 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite.
What is the SMILES notation for 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite?
The canonical SMILES for 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite is CCc1c(OC)c(C)c(C)c(COO)c1OCCSI.
What is the InChIKey of 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite?
The InChIKey is MZLCTQDZDFXSJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21IO4S/c1-5-11-13(17-4)10(3)9(2)12(8-19-16)14(11)18-6-7-20-15/h16H,5-8H2,1-4H3.
What are the key properties of 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite?
2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite has a molecular weight of 412.29 g/mol, XLogP of 4.33, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-ethyl-6-(hydroperoxymethyl)-3-methoxy-4,5-dimethylphenoxy]ethyl thiohypoiodite is sourced from PubChem (CID 142985499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).