C15H19BrINO4 — CID 142985694
(1R,4R,5S)-4-(2-bromoethyl)-1-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-(iodomethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 142985694) has the molecular formula C15H19BrINO4 and a molecular weight of 484.13 g/mol. Its IUPAC name is (1R,4R,5S)-4-(2-bromoethyl)-1-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-(iodomethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,4R,5S)-4-(2-bromoethyl)-1-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-(iodomethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 142985694 |
| Molecular Formula | C15H19BrINO4 |
| Molecular Weight | 484.13 g/mol |
| Exact Mass | 482.95 |
| IUPAC Name | (1R,4R,5S)-4-(2-bromoethyl)-1-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-(iodomethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | O=C1N[C@@]2(C(O)[C@@H]3C=CCCC3)C(=O)O[C@@]2(CI)[C@H]1CCBr |
| InChI | InChI=1S/C15H19BrINO4/c16-7-6-10-12(20)18-15(13(21)22-14(10,15)8-17)11(19)9-4-2-1-3-5-9/h2,4,9-11,19H,1,3,5-8H2,(H,18,20)/t9-,10+,11?,14+,15+/m1/s1 |
| InChIKey | CKYAVXDVQKZHRV-BOZRLRFCSA-N |
| XLogP | 1.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.13 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|