About 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine
2-methyl-N,N-bis(2-methylbutyl)butan-1-amine (PubChem CID 14298629) has the molecular formula C15H33N
and a molecular weight of 227.44 g/mol. Its IUPAC name is 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine |
| PubChem CID | 14298629 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine |
| SMILES | CCC(C)CN(CC(C)CC)CC(C)CC |
| InChI | InChI=1S/C15H33N/c1-7-13(4)10-16(11-14(5)8-2)12-15(6)9-3/h13-15H,7-12H2,1-6H3 |
| InChIKey | JZFBJRHPXVDQIM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine?
The IUPAC name of 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine (CID 14298629) is 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine.
What is the SMILES notation for 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine?
The canonical SMILES for 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine is CCC(C)CN(CC(C)CC)CC(C)CC.
What is the InChIKey of 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine?
The InChIKey is JZFBJRHPXVDQIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33N/c1-7-13(4)10-16(11-14(5)8-2)12-15(6)9-3/h13-15H,7-12H2,1-6H3.
What are the key properties of 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine?
2-methyl-N,N-bis(2-methylbutyl)butan-1-amine has a molecular weight of 227.44 g/mol, XLogP of 4.43, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,N-bis(2-methylbutyl)butan-1-amine is sourced from PubChem (CID 14298629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).