C26H35N7O2 — CID 142986421
(Z)-N-(6-acetyl-8-cyclohexyl-5-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)-N'-ethenyl-4-piperazin-1-ylbut-2-enimidamide (PubChem CID 142986421) has the molecular formula C26H35N7O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is (Z)-N-(6-acetyl-8-cyclohexyl-5-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)-N'-ethenyl-4-piperazin-1-ylbut-2-enimidamide.
| Compound Name | (Z)-N-(6-acetyl-8-cyclohexyl-5-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)-N'-ethenyl-4-piperazin-1-ylbut-2-enimidamide |
|---|---|
| PubChem CID | 142986421 |
| Molecular Formula | C26H35N7O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | (Z)-N-(6-acetyl-8-cyclohexyl-5-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)-N'-ethenyl-4-piperazin-1-ylbut-2-enimidamide |
| SMILES | C=C/N=C(\C=C/CN1CCNCC1)Nc1ncc2c(C)c(C(C)=O)c(=O)n(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C26H35N7O2/c1-4-28-22(11-8-14-32-15-12-27-13-16-32)30-26-29-17-21-18(2)23(19(3)34)25(35)33(24(21)31-26)20-9-6-5-7-10-20/h4,8,11,17,20,27H,1,5-7,9-10,12-16H2,2-3H3,(H,28,29,30,31)/b11-8- |
| InChIKey | DEGRKUBFFKOYLQ-FLIBITNWSA-N |
| XLogP | 3.22 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|