About (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane
(3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane (PubChem CID 142986649) has the molecular formula C19H35NO2
and a molecular weight of 309.49 g/mol. Its IUPAC name is (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane.
Molecular Properties
| Compound Name | (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane |
| PubChem CID | 142986649 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane |
| SMILES | C=C(/C=C(C)\C=C(/C)OC)C(=O)N(CCC)CCCC.CC |
| InChI | InChI=1S/C17H29NO2.C2H6/c1-7-9-11-18(10-8-2)17(19)15(4)12-14(3)13-16(5)20-6;1-2/h12-13H,4,7-11H2,1-3,5-6H3;1-2H3/b14-12-,16-13+; |
| InChIKey | DKCQLWDEQFJKSA-JBGMGLODSA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane?
The IUPAC name of (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane (CID 142986649) is (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane.
What is the SMILES notation for (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane?
The canonical SMILES for (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane is C=C(/C=C(C)\C=C(/C)OC)C(=O)N(CCC)CCCC.CC.
What is the InChIKey of (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane?
The InChIKey is DKCQLWDEQFJKSA-JBGMGLODSA-N. The full InChI is InChI=1S/C17H29NO2.C2H6/c1-7-9-11-18(10-8-2)17(19)15(4)12-14(3)13-16(5)20-6;1-2/h12-13H,4,7-11H2,1-3,5-6H3;1-2H3/b14-12-,16-13+;.
What are the key properties of (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane?
(3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane has a molecular weight of 309.49 g/mol, XLogP of 5.10, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-N-butyl-6-methoxy-4-methyl-2-methylidene-N-propylhepta-3,5-dienamide;ethane is sourced from PubChem (CID 142986649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).