4H-azepine-2,7-dicarboxylic acid

C8H7NO4 — CID 142986724

IUPAC4H-azepine-2,7-dicarboxylic acid
SMILESO=C(O)C1=CCC=CC(C(=O)O)=N1
InChIInChI=1S/C8H7NO4/c10-7(11)5-3-1-2-4-6(9-5)8(12)13/h1,3-4H,2H2,(H,10,11)(H,12,13)
InChIKeyBJQDWEKKCCEHQG-UHFFFAOYSA-N
MW181.15 g/mol
LogP0.44
Rot. Bonds2

About 4H-azepine-2,7-dicarboxylic acid

4H-azepine-2,7-dicarboxylic acid (PubChem CID 142986724) has the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. Its IUPAC name is 4H-azepine-2,7-dicarboxylic acid.

Molecular Properties

Compound Name4H-azepine-2,7-dicarboxylic acid
PubChem CID142986724
Molecular FormulaC8H7NO4
Molecular Weight181.15 g/mol
Exact Mass181.04
IUPAC Name4H-azepine-2,7-dicarboxylic acid
SMILESO=C(O)C1=CCC=CC(C(=O)O)=N1
InChIInChI=1S/C8H7NO4/c10-7(11)5-3-1-2-4-6(9-5)8(12)13/h1,3-4H,2H2,(H,10,11)(H,12,13)
InChIKeyBJQDWEKKCCEHQG-UHFFFAOYSA-N
XLogP0.44
TPSA86.96 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.15
LogP ≤ 50.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4H-azepine-2,7-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4H-azepine-2,7-dicarboxylic acid?
The IUPAC name of 4H-azepine-2,7-dicarboxylic acid (CID 142986724) is 4H-azepine-2,7-dicarboxylic acid.
What is the SMILES notation for 4H-azepine-2,7-dicarboxylic acid?
The canonical SMILES for 4H-azepine-2,7-dicarboxylic acid is O=C(O)C1=CCC=CC(C(=O)O)=N1.
What is the InChIKey of 4H-azepine-2,7-dicarboxylic acid?
The InChIKey is BJQDWEKKCCEHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4/c10-7(11)5-3-1-2-4-6(9-5)8(12)13/h1,3-4H,2H2,(H,10,11)(H,12,13).
What are the key properties of 4H-azepine-2,7-dicarboxylic acid?
4H-azepine-2,7-dicarboxylic acid has a molecular weight of 181.15 g/mol, XLogP of 0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-azepine-2,7-dicarboxylic acid is sourced from PubChem (CID 142986724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).