About 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene
1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene (PubChem CID 142986791) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene.
Molecular Properties
| Compound Name | 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene |
| PubChem CID | 142986791 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene |
| SMILES | C=CCC=C/C=C(\C)c1ccccc1C |
| InChI | InChI=1S/C15H18/c1-4-5-6-7-10-13(2)15-12-9-8-11-14(15)3/h4,6-12H,1,5H2,2-3H3/b7-6?,13-10+ |
| InChIKey | IWMGVLQGTZFZRH-ZAWWDXNVSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene?
The IUPAC name of 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene (CID 142986791) is 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene.
What is the SMILES notation for 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene?
The canonical SMILES for 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene is C=CCC=C/C=C(\C)c1ccccc1C.
What is the InChIKey of 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene?
The InChIKey is IWMGVLQGTZFZRH-ZAWWDXNVSA-N. The full InChI is InChI=1S/C15H18/c1-4-5-6-7-10-13(2)15-12-9-8-11-14(15)3/h4,6-12H,1,5H2,2-3H3/b7-6?,13-10+.
What are the key properties of 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene?
1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene has a molecular weight of 198.31 g/mol, XLogP of 4.53, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-[(2E)-octa-2,4,7-trien-2-yl]benzene is sourced from PubChem (CID 142986791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).