About 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine
4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine (PubChem CID 142987025) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine.
Molecular Properties
| Compound Name | 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine |
| PubChem CID | 142987025 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine |
| SMILES | C=CC1=C(C)N=NCC1C=C |
| InChI | InChI=1S/C9H12N2/c1-4-8-6-10-11-7(3)9(8)5-2/h4-5,8H,1-2,6H2,3H3 |
| InChIKey | TYMADVTWDJXNMD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine?
The IUPAC name of 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine (CID 142987025) is 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine.
What is the SMILES notation for 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine?
The canonical SMILES for 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine is C=CC1=C(C)N=NCC1C=C.
What is the InChIKey of 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine?
The InChIKey is TYMADVTWDJXNMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-4-8-6-10-11-7(3)9(8)5-2/h4-5,8H,1-2,6H2,3H3.
What are the key properties of 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine?
4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine has a molecular weight of 148.21 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethenyl)-6-methyl-3,4-dihydropyridazine is sourced from PubChem (CID 142987025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).