About 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile
4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile (PubChem CID 142987041) has the molecular formula C9H6FN3
and a molecular weight of 175.17 g/mol. Its IUPAC name is 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile.
Molecular Properties
| Compound Name | 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile |
| PubChem CID | 142987041 |
| Molecular Formula | C9H6FN3 |
| Molecular Weight | 175.17 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile |
| SMILES | N#CC1=c2[nH]ccc2=C(F)CC=N1 |
| InChI | InChI=1S/C9H6FN3/c10-7-2-4-12-8(5-11)9-6(7)1-3-13-9/h1,3-4,13H,2H2 |
| InChIKey | BTYPRPJBGUBDJE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 51.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile?
The IUPAC name of 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile (CID 142987041) is 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile.
What is the SMILES notation for 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile?
The canonical SMILES for 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile is N#CC1=c2[nH]ccc2=C(F)CC=N1.
What is the InChIKey of 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile?
The InChIKey is BTYPRPJBGUBDJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FN3/c10-7-2-4-12-8(5-11)9-6(7)1-3-13-9/h1,3-4,13H,2H2.
What are the key properties of 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile?
4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile has a molecular weight of 175.17 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,5-dihydropyrrolo[2,3-c]azepine-8-carbonitrile is sourced from PubChem (CID 142987041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).