About (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene
(2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene (PubChem CID 142987155) has the molecular formula C19H35N3O
and a molecular weight of 321.51 g/mol. Its IUPAC name is (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene.
Molecular Properties
| Compound Name | (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene |
| PubChem CID | 142987155 |
| Molecular Formula | C19H35N3O |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.28 |
| IUPAC Name | (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene |
| SMILES | CCC[C@H](NCC(C)N)C(=O)NCC(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C12H27N3O.C7H8/c1-5-6-11(14-8-10(4)13)12(16)15-7-9(2)3;1-7-5-3-2-4-6-7/h9-11,14H,5-8,13H2,1-4H3,(H,15,16);2-6H,1H3/t10?,11-;/m0./s1 |
| InChIKey | KEEINUSQMYRMAJ-GQNCZFCYSA-N |
| XLogP | 2.86 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene?
The IUPAC name of (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene (CID 142987155) is (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene.
What is the SMILES notation for (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene?
The canonical SMILES for (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene is CCC[C@H](NCC(C)N)C(=O)NCC(C)C.Cc1ccccc1.
What is the InChIKey of (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene?
The InChIKey is KEEINUSQMYRMAJ-GQNCZFCYSA-N. The full InChI is InChI=1S/C12H27N3O.C7H8/c1-5-6-11(14-8-10(4)13)12(16)15-7-9(2)3;1-7-5-3-2-4-6-7/h9-11,14H,5-8,13H2,1-4H3,(H,15,16);2-6H,1H3/t10?,11-;/m0./s1.
What are the key properties of (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene?
(2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene has a molecular weight of 321.51 g/mol, XLogP of 2.86, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2-aminopropylamino)-N-(2-methylpropyl)pentanamide;toluene is sourced from PubChem (CID 142987155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).