About N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide
N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide (PubChem CID 142987772) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide |
| PubChem CID | 142987772 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide |
| SMILES | C=CN(/C=N/C)CCCN |
| InChI | InChI=1S/C7H15N3/c1-3-10(7-9-2)6-4-5-8/h3,7H,1,4-6,8H2,2H3/b9-7+ |
| InChIKey | STYPSUUUJMSXSP-VQHVLOKHSA-N |
| XLogP | 0.44 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide?
The IUPAC name of N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide (CID 142987772) is N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide.
What is the SMILES notation for N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide?
The canonical SMILES for N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide is C=CN(/C=N/C)CCCN.
What is the InChIKey of N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide?
The InChIKey is STYPSUUUJMSXSP-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H15N3/c1-3-10(7-9-2)6-4-5-8/h3,7H,1,4-6,8H2,2H3/b9-7+.
What are the key properties of N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide?
N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide has a molecular weight of 141.22 g/mol, XLogP of 0.44, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide is sourced from PubChem (CID 142987772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).