C25H29ClN6O3 — CID 142988261
N-[5-(4-chlorophenyl)-2-[N-cyano-N'-[2-(4-hydroxy-3-methoxyphenyl)ethyl]carbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethylpropanamide (PubChem CID 142988261) has the molecular formula C25H29ClN6O3 and a molecular weight of 497.00 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-2-[N-cyano-N'-[2-(4-hydroxy-3-methoxyphenyl)ethyl]carbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethylpropanamide.
| Compound Name | N-[5-(4-chlorophenyl)-2-[N-cyano-N'-[2-(4-hydroxy-3-methoxyphenyl)ethyl]carbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 142988261 |
| Molecular Formula | C25H29ClN6O3 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-[5-(4-chlorophenyl)-2-[N-cyano-N'-[2-(4-hydroxy-3-methoxyphenyl)ethyl]carbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethylpropanamide |
| SMILES | CCC(=O)N(CC)C1CN(/C(=N/CCc2ccc(O)c(OC)c2)NC#N)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H29ClN6O3/c1-4-23(34)31(5-2)20-15-32(30-24(20)18-7-9-19(26)10-8-18)25(29-16-27)28-13-12-17-6-11-21(33)22(14-17)35-3/h6-11,14,20,33H,4-5,12-13,15H2,1-3H3,(H,28,29) |
| InChIKey | KDHKOKPIJFSMJD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|