C23H20Cl2F2N6O — CID 142988310
5-(4-chlorophenyl)-N'-[2-(4-chlorophenyl)-2,2-difluoroethyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988310) has the molecular formula C23H20Cl2F2N6O and a molecular weight of 505.36 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-[2-(4-chlorophenyl)-2,2-difluoroethyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N'-[2-(4-chlorophenyl)-2,2-difluoroethyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988310 |
| Molecular Formula | C23H20Cl2F2N6O |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-[2-(4-chlorophenyl)-2,2-difluoroethyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#CN/C(=N\CC(F)(F)c1ccc(Cl)cc1)N1CC(N2CCCC2=O)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H20Cl2F2N6O/c24-17-7-3-15(4-8-17)21-19(32-11-1-2-20(32)34)12-33(31-21)22(30-14-28)29-13-23(26,27)16-5-9-18(25)10-6-16/h3-10,19H,1-2,11-13H2,(H,29,30) |
| InChIKey | NTBROYGTOBCLOE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|