C23H29ClN6O — CID 142988313
5-(4-chlorophenyl)-N-cyano-N'-(2,4-dimethylcyclohexyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988313) has the molecular formula C23H29ClN6O and a molecular weight of 440.98 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-cyano-N'-(2,4-dimethylcyclohexyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N-cyano-N'-(2,4-dimethylcyclohexyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988313 |
| Molecular Formula | C23H29ClN6O |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 5-(4-chlorophenyl)-N-cyano-N'-(2,4-dimethylcyclohexyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC1CCC(/N=C(\NC#N)N2CC(N3CCCC3=O)C(c3ccc(Cl)cc3)=N2)C(C)C1 |
| InChI | InChI=1S/C23H29ClN6O/c1-15-5-10-19(16(2)12-15)27-23(26-14-25)30-13-20(29-11-3-4-21(29)31)22(28-30)17-6-8-18(24)9-7-17/h6-9,15-16,19-20H,3-5,10-13H2,1-2H3,(H,26,27) |
| InChIKey | DIZPQAHZTHIYJN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|