C23H22F2N6O — CID 142988357
N-cyano-5-(2,4-difluorophenyl)-4-(2-oxopyrrolidin-1-yl)-N'-(2-phenylethyl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988357) has the molecular formula C23H22F2N6O and a molecular weight of 436.47 g/mol. Its IUPAC name is N-cyano-5-(2,4-difluorophenyl)-4-(2-oxopyrrolidin-1-yl)-N'-(2-phenylethyl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-cyano-5-(2,4-difluorophenyl)-4-(2-oxopyrrolidin-1-yl)-N'-(2-phenylethyl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988357 |
| Molecular Formula | C23H22F2N6O |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-cyano-5-(2,4-difluorophenyl)-4-(2-oxopyrrolidin-1-yl)-N'-(2-phenylethyl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#CN/C(=N\CCc1ccccc1)N1CC(N2CCCC2=O)C(c2ccc(F)cc2F)=N1 |
| InChI | InChI=1S/C23H22F2N6O/c24-17-8-9-18(19(25)13-17)22-20(30-12-4-7-21(30)32)14-31(29-22)23(28-15-26)27-11-10-16-5-2-1-3-6-16/h1-3,5-6,8-9,13,20H,4,7,10-12,14H2,(H,27,28) |
| InChIKey | BNMLMXBLIWCGRE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|