C24H24ClF3N6O — CID 142988393
5-(4-chloro-6-methylcyclohexa-1,3-dien-1-yl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988393) has the molecular formula C24H24ClF3N6O and a molecular weight of 504.94 g/mol. Its IUPAC name is 5-(4-chloro-6-methylcyclohexa-1,3-dien-1-yl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chloro-6-methylcyclohexa-1,3-dien-1-yl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988393 |
| Molecular Formula | C24H24ClF3N6O |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 5-(4-chloro-6-methylcyclohexa-1,3-dien-1-yl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC1CC(Cl)=CC=C1C1=NN(/C(=N/Cc2cccc(C(F)(F)F)c2)NC#N)CC1N1CCCC1=O |
| InChI | InChI=1S/C24H24ClF3N6O/c1-15-10-18(25)7-8-19(15)22-20(33-9-3-6-21(33)35)13-34(32-22)23(31-14-29)30-12-16-4-2-5-17(11-16)24(26,27)28/h2,4-5,7-8,11,15,20H,3,6,9-10,12-13H2,1H3,(H,30,31) |
| InChIKey | XNUKRQSGMVLZJD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|