C23H21ClF2N6O — CID 142988422
5-(4-chlorophenyl)-N-cyano-N'-(2,2-difluoro-2-phenylethyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988422) has the molecular formula C23H21ClF2N6O and a molecular weight of 470.91 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-cyano-N'-(2,2-difluoro-2-phenylethyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N-cyano-N'-(2,2-difluoro-2-phenylethyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988422 |
| Molecular Formula | C23H21ClF2N6O |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 5-(4-chlorophenyl)-N-cyano-N'-(2,2-difluoro-2-phenylethyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#CN/C(=N\CC(F)(F)c1ccccc1)N1CC(N2CCCC2=O)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H21ClF2N6O/c24-18-10-8-16(9-11-18)21-19(31-12-4-7-20(31)33)13-32(30-21)22(29-15-27)28-14-23(25,26)17-5-2-1-3-6-17/h1-3,5-6,8-11,19H,4,7,12-14H2,(H,28,29) |
| InChIKey | SZLSKIPGTSZWCV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|