C21H24BrCl2N3O2 — CID 142988435
1-[5-(4-bromocyclohexyl)-2-[2-(3,4-dichlorophenyl)acetyl]-3,4-dihydropyrazol-4-yl]pyrrolidin-2-one (PubChem CID 142988435) has the molecular formula C21H24BrCl2N3O2 and a molecular weight of 501.25 g/mol. Its IUPAC name is 1-[5-(4-bromocyclohexyl)-2-[2-(3,4-dichlorophenyl)acetyl]-3,4-dihydropyrazol-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[5-(4-bromocyclohexyl)-2-[2-(3,4-dichlorophenyl)acetyl]-3,4-dihydropyrazol-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 142988435 |
| Molecular Formula | C21H24BrCl2N3O2 |
| Molecular Weight | 501.25 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 1-[5-(4-bromocyclohexyl)-2-[2-(3,4-dichlorophenyl)acetyl]-3,4-dihydropyrazol-4-yl]pyrrolidin-2-one |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1CC(N2CCCC2=O)C(C2CCC(Br)CC2)=N1 |
| InChI | InChI=1S/C21H24BrCl2N3O2/c22-15-6-4-14(5-7-15)21-18(26-9-1-2-19(26)28)12-27(25-21)20(29)11-13-3-8-16(23)17(24)10-13/h3,8,10,14-15,18H,1-2,4-7,9,11-12H2 |
| InChIKey | CSHGHZOYQKPHBX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.25 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|