C18H17Cl2F3N6OS — CID 142988479
N-cyano-5-(3,4-dichlorophenyl)-4-(2-oxopyrrolidin-1-yl)-N'-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988479) has the molecular formula C18H17Cl2F3N6OS and a molecular weight of 493.34 g/mol. Its IUPAC name is N-cyano-5-(3,4-dichlorophenyl)-4-(2-oxopyrrolidin-1-yl)-N'-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-cyano-5-(3,4-dichlorophenyl)-4-(2-oxopyrrolidin-1-yl)-N'-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988479 |
| Molecular Formula | C18H17Cl2F3N6OS |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | N-cyano-5-(3,4-dichlorophenyl)-4-(2-oxopyrrolidin-1-yl)-N'-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#CN/C(=N\CCSC(F)(F)F)N1CC(N2CCCC2=O)C(c2ccc(Cl)c(Cl)c2)=N1 |
| InChI | InChI=1S/C18H17Cl2F3N6OS/c19-12-4-3-11(8-13(12)20)16-14(28-6-1-2-15(28)30)9-29(27-16)17(26-10-24)25-5-7-31-18(21,22)23/h3-4,8,14H,1-2,5-7,9H2,(H,25,26) |
| InChIKey | VQLRLKAMRQNFRQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|