C20H22ClF3N6O — CID 142988489
5-(4-chlorophenyl)-N-cyano-4-(2-oxopiperidin-1-yl)-N'-(4,4,4-trifluorobutyl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988489) has the molecular formula C20H22ClF3N6O and a molecular weight of 454.88 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-cyano-4-(2-oxopiperidin-1-yl)-N'-(4,4,4-trifluorobutyl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N-cyano-4-(2-oxopiperidin-1-yl)-N'-(4,4,4-trifluorobutyl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988489 |
| Molecular Formula | C20H22ClF3N6O |
| Molecular Weight | 454.88 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 5-(4-chlorophenyl)-N-cyano-4-(2-oxopiperidin-1-yl)-N'-(4,4,4-trifluorobutyl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#CN/C(=N\CCCC(F)(F)F)N1CC(N2CCCCC2=O)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C20H22ClF3N6O/c21-15-7-5-14(6-8-15)18-16(29-11-2-1-4-17(29)31)12-30(28-18)19(27-13-25)26-10-3-9-20(22,23)24/h5-8,16H,1-4,9-12H2,(H,26,27) |
| InChIKey | YLGVNLKREAXYDC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|