C23H26ClF3N6O2 — CID 142988506
5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[3-(2,2,3-trifluoropent-4-enoxy)propyl]-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988506) has the molecular formula C23H26ClF3N6O2 and a molecular weight of 510.95 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[3-(2,2,3-trifluoropent-4-enoxy)propyl]-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[3-(2,2,3-trifluoropent-4-enoxy)propyl]-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988506 |
| Molecular Formula | C23H26ClF3N6O2 |
| Molecular Weight | 510.95 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[3-(2,2,3-trifluoropent-4-enoxy)propyl]-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | C=CC(F)C(F)(F)COCCC/N=C(\NC#N)N1CC(N2CCCC2=O)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H26ClF3N6O2/c1-2-19(25)23(26,27)14-35-12-4-10-29-22(30-15-28)33-13-18(32-11-3-5-20(32)34)21(31-33)16-6-8-17(24)9-7-16/h2,6-9,18-19H,1,3-5,10-14H2,(H,29,30) |
| InChIKey | ZARUUJQDWDQYLW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.95 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|