C20H18ClF3N4O — CID 1429886
4-(6-chloro-1H-benzimidazol-2-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 1429886) has the molecular formula C20H18ClF3N4O and a molecular weight of 422.84 g/mol. Its IUPAC name is 4-(6-chloro-1H-benzimidazol-2-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(6-chloro-1H-benzimidazol-2-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 1429886 |
| Molecular Formula | C20H18ClF3N4O |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 4-(6-chloro-1H-benzimidazol-2-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)N1CCC(c2nc3ccc(Cl)cc3[nH]2)CC1 |
| InChI | InChI=1S/C20H18ClF3N4O/c21-13-5-6-16-17(11-13)26-18(25-16)12-7-9-28(10-8-12)19(29)27-15-4-2-1-3-14(15)20(22,23)24/h1-6,11-12H,7-10H2,(H,25,26)(H,27,29) |
| InChIKey | JCSRVNGTESUGTC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |