C10H12N2O — CID 142988736
1,3,4,7-tetrahydropyrido[3,4-c]azepine-2-carbaldehyde (PubChem CID 142988736) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 1,3,4,7-tetrahydropyrido[3,4-c]azepine-2-carbaldehyde.
| Compound Name | 1,3,4,7-tetrahydropyrido[3,4-c]azepine-2-carbaldehyde |
|---|---|
| PubChem CID | 142988736 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1,3,4,7-tetrahydropyrido[3,4-c]azepine-2-carbaldehyde |
| SMILES | O=CN1CCC2=C(C=NCC=C2)C1 |
| InChI | InChI=1S/C10H12N2O/c13-8-12-5-3-9-2-1-4-11-6-10(9)7-12/h1-2,6,8H,3-5,7H2 |
| InChIKey | FRLFNMXRERRFLG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|