C12H23NO2 — CID 142989375
1-[(2S,4R)-4-(3-ethoxypropyl)piperidin-2-yl]ethanone (PubChem CID 142989375) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-[(2S,4R)-4-(3-ethoxypropyl)piperidin-2-yl]ethanone.
| Compound Name | 1-[(2S,4R)-4-(3-ethoxypropyl)piperidin-2-yl]ethanone |
|---|---|
| PubChem CID | 142989375 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-[(2S,4R)-4-(3-ethoxypropyl)piperidin-2-yl]ethanone |
| SMILES | CCOCCC[C@@H]1CCN[C@H](C(C)=O)C1 |
| InChI | InChI=1S/C12H23NO2/c1-3-15-8-4-5-11-6-7-13-12(9-11)10(2)14/h11-13H,3-9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | RCCGINSANXAHQA-NEPJUHHUSA-N |
| XLogP | 1.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|