C20H35NO — CID 142989476
N-[(1E)-2-(1-cyclohexa-1,5-dien-1-yloxy-2-methylpropan-2-yl)buta-1,3-dienyl]ethanimine;ethane (PubChem CID 142989476) has the molecular formula C20H35NO and a molecular weight of 305.51 g/mol. Its IUPAC name is N-[(1E)-2-(1-cyclohexa-1,5-dien-1-yloxy-2-methylpropan-2-yl)buta-1,3-dienyl]ethanimine;ethane.
| Compound Name | N-[(1E)-2-(1-cyclohexa-1,5-dien-1-yloxy-2-methylpropan-2-yl)buta-1,3-dienyl]ethanimine;ethane |
|---|---|
| PubChem CID | 142989476 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | N-[(1E)-2-(1-cyclohexa-1,5-dien-1-yloxy-2-methylpropan-2-yl)buta-1,3-dienyl]ethanimine;ethane |
| SMILES | C=C/C(=C\N=C\C)C(C)(C)COC1=CCCC=C1.CC.CC |
| InChI | InChI=1S/C16H23NO.2C2H6/c1-5-14(12-17-6-2)16(3,4)13-18-15-10-8-7-9-11-15;2*1-2/h5-6,8,10-12H,1,7,9,13H2,2-4H3;2*1-2H3/b14-12+,17-6+;; |
| InChIKey | RTNDXJAMYSJRPH-CDMRTEHNSA-N |
| XLogP | 6.48 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|