C21H25N3O — CID 142989606
3-methyl-N-(1-methylpiperidin-4-yl)pyridin-2-amine;3-phenylprop-2-ynal (PubChem CID 142989606) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-methyl-N-(1-methylpiperidin-4-yl)pyridin-2-amine;3-phenylprop-2-ynal.
| Compound Name | 3-methyl-N-(1-methylpiperidin-4-yl)pyridin-2-amine;3-phenylprop-2-ynal |
|---|---|
| PubChem CID | 142989606 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 3-methyl-N-(1-methylpiperidin-4-yl)pyridin-2-amine;3-phenylprop-2-ynal |
| SMILES | Cc1cccnc1NC1CCN(C)CC1.O=CC#Cc1ccccc1 |
| InChI | InChI=1S/C12H19N3.C9H6O/c1-10-4-3-7-13-12(10)14-11-5-8-15(2)9-6-11;10-8-4-7-9-5-2-1-3-6-9/h3-4,7,11H,5-6,8-9H2,1-2H3,(H,13,14);1-3,5-6,8H |
| InChIKey | NGMYDUSRGWVSHF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|