C17H22N3O3S+ — CID 142990481
hydroxy-methyl-[5-[(4-thiomorpholin-4-ylphenyl)methylcarbamoyl]furan-2-yl]azanium (PubChem CID 142990481) has the molecular formula C17H22N3O3S+ and a molecular weight of 348.45 g/mol. Its IUPAC name is hydroxy-methyl-[5-[(4-thiomorpholin-4-ylphenyl)methylcarbamoyl]furan-2-yl]azanium.
| Compound Name | hydroxy-methyl-[5-[(4-thiomorpholin-4-ylphenyl)methylcarbamoyl]furan-2-yl]azanium |
|---|---|
| PubChem CID | 142990481 |
| Molecular Formula | C17H22N3O3S+ |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | hydroxy-methyl-[5-[(4-thiomorpholin-4-ylphenyl)methylcarbamoyl]furan-2-yl]azanium |
| SMILES | C[NH+](O)c1ccc(C(=O)NCc2ccc(N3CCSCC3)cc2)o1 |
| InChI | InChI=1S/C17H21N3O3S/c1-19(22)16-7-6-15(23-16)17(21)18-12-13-2-4-14(5-3-13)20-8-10-24-11-9-20/h2-7,22H,8-12H2,1H3,(H,18,21)/p+1 |
| InChIKey | ARSMRUXMDHTVDL-UHFFFAOYSA-O |
| XLogP | 1.30 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|