C32H25F6N3O9 — CID 142990517
(2,5-dioxopyrrolidin-1-yl) acetate;2,2,2-trifluoro-N-[5-oxo-3,4-bis[(Z)-prop-1-enyl]-6'-[(2,2,2-trifluoroacetyl)amino]spiro[furan-2,9'-xanthene]-3'-yl]acetamide (PubChem CID 142990517) has the molecular formula C32H25F6N3O9 and a molecular weight of 709.55 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) acetate;2,2,2-trifluoro-N-[5-oxo-3,4-bis[(Z)-prop-1-enyl]-6'-[(2,2,2-trifluoroacetyl)amino]spiro[furan-2,9'-xanthene]-3'-yl]acetamide.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) acetate;2,2,2-trifluoro-N-[5-oxo-3,4-bis[(Z)-prop-1-enyl]-6'-[(2,2,2-trifluoroacetyl)amino]spiro[furan-2,9'-xanthene]-3'-yl]acetamide |
|---|---|
| PubChem CID | 142990517 |
| Molecular Formula | C32H25F6N3O9 |
| Molecular Weight | 709.55 g/mol |
| Exact Mass | 709.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) acetate;2,2,2-trifluoro-N-[5-oxo-3,4-bis[(Z)-prop-1-enyl]-6'-[(2,2,2-trifluoroacetyl)amino]spiro[furan-2,9'-xanthene]-3'-yl]acetamide |
| SMILES | C/C=C\C1=C(/C=C\C)C2(OC1=O)c1ccc(NC(=O)C(F)(F)F)cc1Oc1cc(NC(=O)C(F)(F)F)ccc12.CC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C26H18F6N2O5.C6H7NO4/c1-3-5-15-16(6-4-2)24(39-21(15)35)17-9-7-13(33-22(36)25(27,28)29)11-19(17)38-20-12-14(8-10-18(20)24)34-23(37)26(30,31)32;1-4(8)11-7-5(9)2-3-6(7)10/h3-12H,1-2H3,(H,33,36)(H,34,37);2-3H2,1H3/b5-3-,6-4-; |
| InChIKey | JOAOUNYVADQJHR-VIOUERSGSA-N |
| XLogP | 5.66 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|