C26H34F5N7 — CID 142990937
4-[(1E,3E,5E)-1,6-difluorohexa-1,3,5-trien-3-yl]-N-ethyl-N-propan-2-yl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazin-2-amine;ethane (PubChem CID 142990937) has the molecular formula C26H34F5N7 and a molecular weight of 539.60 g/mol. Its IUPAC name is 4-[(1E,3E,5E)-1,6-difluorohexa-1,3,5-trien-3-yl]-N-ethyl-N-propan-2-yl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazin-2-amine;ethane.
| Compound Name | 4-[(1E,3E,5E)-1,6-difluorohexa-1,3,5-trien-3-yl]-N-ethyl-N-propan-2-yl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazin-2-amine;ethane |
|---|---|
| PubChem CID | 142990937 |
| Molecular Formula | C26H34F5N7 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | 4-[(1E,3E,5E)-1,6-difluorohexa-1,3,5-trien-3-yl]-N-ethyl-N-propan-2-yl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazin-2-amine;ethane |
| SMILES | CC.CCN(c1nc(C(/C=C/F)=C/C=C/F)nc(N2CCN(c3ncccc3C(F)(F)F)CC2)n1)C(C)C |
| InChI | InChI=1S/C24H28F5N7.C2H6/c1-4-36(17(2)3)23-32-20(18(9-11-26)7-5-10-25)31-22(33-23)35-15-13-34(14-16-35)21-19(24(27,28)29)8-6-12-30-21;1-2/h5-12,17H,4,13-16H2,1-3H3;1-2H3/b10-5+,11-9+,18-7+; |
| InChIKey | OAMWFKPNBCAARQ-PBPAGTSLSA-N |
| XLogP | 6.22 |
| TPSA | 61.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|