About 3H-1,3-benzothiazole-2-thione;cyclohexanamine
3H-1,3-benzothiazole-2-thione;cyclohexanamine (PubChem CID 14299121) has the molecular formula C13H18N2S2
and a molecular weight of 266.44 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;cyclohexanamine.
Molecular Properties
| Compound Name | 3H-1,3-benzothiazole-2-thione;cyclohexanamine |
| PubChem CID | 14299121 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;cyclohexanamine |
| SMILES | NC1CCCCC1.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2.C6H13N/c9-7-8-5-3-1-2-4-6(5)10-7;7-6-4-2-1-3-5-6/h1-4H,(H,8,9);6H,1-5,7H2 |
| InChIKey | XTDMOBIAHSICBE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,3-benzothiazole-2-thione;cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,3-benzothiazole-2-thione;cyclohexanamine?
The IUPAC name of 3H-1,3-benzothiazole-2-thione;cyclohexanamine (CID 14299121) is 3H-1,3-benzothiazole-2-thione;cyclohexanamine.
What is the SMILES notation for 3H-1,3-benzothiazole-2-thione;cyclohexanamine?
The canonical SMILES for 3H-1,3-benzothiazole-2-thione;cyclohexanamine is NC1CCCCC1.S=c1[nH]c2ccccc2s1.
What is the InChIKey of 3H-1,3-benzothiazole-2-thione;cyclohexanamine?
The InChIKey is XTDMOBIAHSICBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2.C6H13N/c9-7-8-5-3-1-2-4-6(5)10-7;7-6-4-2-1-3-5-6/h1-4H,(H,8,9);6H,1-5,7H2.
What are the key properties of 3H-1,3-benzothiazole-2-thione;cyclohexanamine?
3H-1,3-benzothiazole-2-thione;cyclohexanamine has a molecular weight of 266.44 g/mol, XLogP of 4.24, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,3-benzothiazole-2-thione;cyclohexanamine is sourced from PubChem (CID 14299121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).