C18H20NO2PS2 — CID 142991354
formaldehyde;(5E)-5-[[4-(3-methylphenyl)cyclopenta-1,3-dien-1-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;methylphosphane (PubChem CID 142991354) has the molecular formula C18H20NO2PS2 and a molecular weight of 377.47 g/mol. Its IUPAC name is formaldehyde;(5E)-5-[[4-(3-methylphenyl)cyclopenta-1,3-dien-1-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;methylphosphane.
| Compound Name | formaldehyde;(5E)-5-[[4-(3-methylphenyl)cyclopenta-1,3-dien-1-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;methylphosphane |
|---|---|
| PubChem CID | 142991354 |
| Molecular Formula | C18H20NO2PS2 |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | formaldehyde;(5E)-5-[[4-(3-methylphenyl)cyclopenta-1,3-dien-1-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;methylphosphane |
| SMILES | C=O.CP.Cc1cccc(C2=CC=C(/C=C3/SC(=S)NC3=O)C2)c1 |
| InChI | InChI=1S/C16H13NOS2.CH2O.CH5P/c1-10-3-2-4-12(7-10)13-6-5-11(8-13)9-14-15(18)17-16(19)20-14;2*1-2/h2-7,9H,8H2,1H3,(H,17,18,19);1H2;2H2,1H3/b14-9+;; |
| InChIKey | GOMUXNKSLNLJLE-CAJRCRMVSA-N |
| XLogP | 4.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|