About (6-methylcyclohepta-1,3,6-trien-1-yl)methanol
(6-methylcyclohepta-1,3,6-trien-1-yl)methanol (PubChem CID 142991536) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is (6-methylcyclohepta-1,3,6-trien-1-yl)methanol.
Molecular Properties
| Compound Name | (6-methylcyclohepta-1,3,6-trien-1-yl)methanol |
| PubChem CID | 142991536 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (6-methylcyclohepta-1,3,6-trien-1-yl)methanol |
| SMILES | CC1=CC(CO)=CC=CC1 |
| InChI | InChI=1S/C9H12O/c1-8-4-2-3-5-9(6-8)7-10/h2-3,5-6,10H,4,7H2,1H3 |
| InChIKey | SOLQVMNUDMBRDE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6-methylcyclohepta-1,3,6-trien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methylcyclohepta-1,3,6-trien-1-yl)methanol?
The IUPAC name of (6-methylcyclohepta-1,3,6-trien-1-yl)methanol (CID 142991536) is (6-methylcyclohepta-1,3,6-trien-1-yl)methanol.
What is the SMILES notation for (6-methylcyclohepta-1,3,6-trien-1-yl)methanol?
The canonical SMILES for (6-methylcyclohepta-1,3,6-trien-1-yl)methanol is CC1=CC(CO)=CC=CC1.
What is the InChIKey of (6-methylcyclohepta-1,3,6-trien-1-yl)methanol?
The InChIKey is SOLQVMNUDMBRDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c1-8-4-2-3-5-9(6-8)7-10/h2-3,5-6,10H,4,7H2,1H3.
What are the key properties of (6-methylcyclohepta-1,3,6-trien-1-yl)methanol?
(6-methylcyclohepta-1,3,6-trien-1-yl)methanol has a molecular weight of 136.19 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methylcyclohepta-1,3,6-trien-1-yl)methanol is sourced from PubChem (CID 142991536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).