C24H32FN3O4S — CID 142992000
5-fluoro-N-[4-[[(Z,2Z)-2-(1-hydroxyethylidene)pent-3-enoyl]amino]cyclohexyl]-2-(thian-4-yloxy)pyridine-3-carboxamide (PubChem CID 142992000) has the molecular formula C24H32FN3O4S and a molecular weight of 477.60 g/mol. Its IUPAC name is 5-fluoro-N-[4-[[(Z,2Z)-2-(1-hydroxyethylidene)pent-3-enoyl]amino]cyclohexyl]-2-(thian-4-yloxy)pyridine-3-carboxamide.
| Compound Name | 5-fluoro-N-[4-[[(Z,2Z)-2-(1-hydroxyethylidene)pent-3-enoyl]amino]cyclohexyl]-2-(thian-4-yloxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142992000 |
| Molecular Formula | C24H32FN3O4S |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 5-fluoro-N-[4-[[(Z,2Z)-2-(1-hydroxyethylidene)pent-3-enoyl]amino]cyclohexyl]-2-(thian-4-yloxy)pyridine-3-carboxamide |
| SMILES | C/C=C\C(C(=O)NC1CCC(NC(=O)c2cc(F)cnc2OC2CCSCC2)CC1)=C(/C)O |
| InChI | InChI=1S/C24H32FN3O4S/c1-3-4-20(15(2)29)22(30)27-17-5-7-18(8-6-17)28-23(31)21-13-16(25)14-26-24(21)32-19-9-11-33-12-10-19/h3-4,13-14,17-19,29H,5-12H2,1-2H3,(H,27,30)(H,28,31)/b4-3-,20-15- |
| InChIKey | HMTNHYDXCCYEKZ-CSFGAOAQSA-N |
| XLogP | 4.06 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|