About 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite
5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite (PubChem CID 142992123) has the molecular formula C8H6FNS2
and a molecular weight of 199.28 g/mol. Its IUPAC name is 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite.
Molecular Properties
| Compound Name | 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite |
| PubChem CID | 142992123 |
| Molecular Formula | C8H6FNS2 |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite |
| SMILES | FSc1nc2c(s1)=CC=CCC=2 |
| InChI | InChI=1S/C8H6FNS2/c9-12-8-10-6-4-2-1-3-5-7(6)11-8/h1,3-5H,2H2 |
| InChIKey | ZYSVPONLHHLRBS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite?
The IUPAC name of 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite (CID 142992123) is 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite.
What is the SMILES notation for 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite?
The canonical SMILES for 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite is FSc1nc2c(s1)=CC=CCC=2.
What is the InChIKey of 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite?
The InChIKey is ZYSVPONLHHLRBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FNS2/c9-12-8-10-6-4-2-1-3-5-7(6)11-8/h1,3-5H,2H2.
What are the key properties of 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite?
5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite has a molecular weight of 199.28 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-cyclohepta[d][1,3]thiazol-2-yl thiohypofluorite is sourced from PubChem (CID 142992123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).