About ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine
ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 142992149) has the molecular formula C9H12O2S
and a molecular weight of 184.26 g/mol. Its IUPAC name is ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
Molecular Properties
| Compound Name | ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| PubChem CID | 142992149 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | C=C.Cc1scc2c1OCCO2 |
| InChI | InChI=1S/C7H8O2S.C2H4/c1-5-7-6(4-10-5)8-2-3-9-7;1-2/h4H,2-3H2,1H3;1-2H2 |
| InChIKey | QNFOHFFHRRQVQA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The IUPAC name of ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (CID 142992149) is ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
What is the SMILES notation for ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The canonical SMILES for ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine is C=C.Cc1scc2c1OCCO2.
What is the InChIKey of ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The InChIKey is QNFOHFFHRRQVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S.C2H4/c1-5-7-6(4-10-5)8-2-3-9-7;1-2/h4H,2-3H2,1H3;1-2H2.
What are the key properties of ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine has a molecular weight of 184.26 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine is sourced from PubChem (CID 142992149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).