C28H38N4O2S — CID 142992221
(1S,2S,6R,7S)-4-[[(1R,2R)-2-[[4-(2-sulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 142992221) has the molecular formula C28H38N4O2S and a molecular weight of 494.71 g/mol. Its IUPAC name is (1S,2S,6R,7S)-4-[[(1R,2R)-2-[[4-(2-sulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2S,6R,7S)-4-[[(1R,2R)-2-[[4-(2-sulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 142992221 |
| Molecular Formula | C28H38N4O2S |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | (1S,2S,6R,7S)-4-[[(1R,2R)-2-[[4-(2-sulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | [H]/N=C(/c1ccccc1S)N1CCN(C[C@@H]2CCCC[C@H]2CN2C(=O)[C@@H]3[C@H]4CC[C@@H](C4)[C@@H]3C2=O)CC1 |
| InChI | InChI=1S/C28H38N4O2S/c29-26(22-7-3-4-8-23(22)35)31-13-11-30(12-14-31)16-20-5-1-2-6-21(20)17-32-27(33)24-18-9-10-19(15-18)25(24)28(32)34/h3-4,7-8,18-21,24-25,29,35H,1-2,5-6,9-17H2/b29-26-/t18-,19-,20-,21-,24-,25+/m0/s1 |
| InChIKey | FHHFCCVMZPUWRR-FGEZDIGQSA-N |
| XLogP | 3.76 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|