C28H40N4O2S — CID 142992222
N-[2-[[(1R,2R)-2-[[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]cyclohexyl]methylamino]ethyl]-N-ethyl-2-sulfanylbenzenecarboximidamide (PubChem CID 142992222) has the molecular formula C28H40N4O2S and a molecular weight of 496.72 g/mol. Its IUPAC name is N-[2-[[(1R,2R)-2-[[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]cyclohexyl]methylamino]ethyl]-N-ethyl-2-sulfanylbenzenecarboximidamide.
| Compound Name | N-[2-[[(1R,2R)-2-[[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]cyclohexyl]methylamino]ethyl]-N-ethyl-2-sulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142992222 |
| Molecular Formula | C28H40N4O2S |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | N-[2-[[(1R,2R)-2-[[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]cyclohexyl]methylamino]ethyl]-N-ethyl-2-sulfanylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccccc1S)N(CC)CCNC[C@@H]1CCCC[C@H]1CN1C(=O)[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C28H40N4O2S/c1-2-31(26(29)22-9-5-6-10-23(22)35)14-13-30-16-20-7-3-4-8-21(20)17-32-27(33)24-18-11-12-19(15-18)25(24)28(32)34/h5-6,9-10,18-21,24-25,29-30,35H,2-4,7-8,11-17H2,1H3/b29-26-/t18-,19+,20-,21-,24-,25+/m0/s1 |
| InChIKey | AKFATRMSNRGPTJ-PGQORHJUSA-N |
| XLogP | 4.05 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|