About (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate
(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate (PubChem CID 142992420) has the molecular formula C21H19FN2O4
and a molecular weight of 382.39 g/mol. Its IUPAC name is (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate.
Molecular Properties
| Compound Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate |
| PubChem CID | 142992420 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate |
| SMILES | Cc1cc(C(C)C(=O)OCn2cc(F)c(=O)[nH]c2=O)ccc1-c1ccccc1 |
| InChI | InChI=1S/C21H19FN2O4/c1-13-10-16(8-9-17(13)15-6-4-3-5-7-15)14(2)20(26)28-12-24-11-18(22)19(25)23-21(24)27/h3-11,14H,12H2,1-2H3,(H,23,25,27) |
| InChIKey | ANGSTYIREMQTRJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate?
The IUPAC name of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate (CID 142992420) is (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate.
What is the SMILES notation for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate?
The canonical SMILES for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate is Cc1cc(C(C)C(=O)OCn2cc(F)c(=O)[nH]c2=O)ccc1-c1ccccc1.
What is the InChIKey of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate?
The InChIKey is ANGSTYIREMQTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN2O4/c1-13-10-16(8-9-17(13)15-6-4-3-5-7-15)14(2)20(26)28-12-24-11-18(22)19(25)23-21(24)27/h3-11,14H,12H2,1-2H3,(H,23,25,27).
What are the key properties of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate?
(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate has a molecular weight of 382.39 g/mol, XLogP of 2.96, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 2-(3-methyl-4-phenylphenyl)propanoate is sourced from PubChem (CID 142992420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).