C12H19N3O — CID 142992432
7,7-diamino-1-pyridin-3-ylheptan-1-one (PubChem CID 142992432) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 7,7-diamino-1-pyridin-3-ylheptan-1-one.
| Compound Name | 7,7-diamino-1-pyridin-3-ylheptan-1-one |
|---|---|
| PubChem CID | 142992432 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 7,7-diamino-1-pyridin-3-ylheptan-1-one |
| SMILES | NC(N)CCCCCC(=O)c1cccnc1 |
| InChI | InChI=1S/C12H19N3O/c13-12(14)7-3-1-2-6-11(16)10-5-4-8-15-9-10/h4-5,8-9,12H,1-3,6-7,13-14H2 |
| InChIKey | BQOULEGBZWQTGB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|